For research use only. Not for therapeutic Use.
Nicotredole（Cat No.:M147711）is an investigational vasodilatory compound that combines nitric oxide (NO) donation with phosphodiesterase (PDE) inhibition to enhance cyclic GMP signaling, promoting smooth muscle relaxation and improved blood flow. Designed to treat cardiovascular conditions such as angina and hypertension, nicotredole aims to provide dual action by both increasing NO availability and preventing cGMP degradation. This synergistic mechanism helps reduce vascular resistance and myocardial oxygen demand. Though still under research, nicotredole holds promise as a novel therapeutic agent for managing cardiovascular diseases with improved efficacy and potentially fewer side effects.
| CAS Number | 29876-14-0 |
| Synonyms | N-[2-(1H-indol-3-yl)ethyl]pyridine-3-carboxamide |
| Molecular Formula | C16H15N3O |
| Purity | ≥95% |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]pyridine-3-carboxamide |
| InChI | InChI=1S/C16H15N3O/c20-16(13-4-3-8-17-10-13)18-9-7-12-11-19-15-6-2-1-5-14(12)15/h1-6,8,10-11,19H,7,9H2,(H,18,20) |
| InChIKey | ZDAZUJBASMCUAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)C3=CN=CC=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
