For research use only. Not for therapeutic Use.
Neoxanthin(Cat No.:M058857)is a carotenoid, a class of naturally occurring pigments found in plants and algae. It is a precursor to other carotenoids like xanthophylls and plays a role in photosynthesis, helping plants absorb light energy and protect against oxidative stress. In humans, neoxanthin is believed to have antioxidant properties, potentially offering protective benefits against oxidative damage and inflammation. Although its precise biological functions are still under investigation, neoxanthin, like other carotenoids, may contribute to eye health, skin protection, and reducing the risk of chronic diseases.
| CAS Number | 14660-91-4 |
| Molecular Formula | C40H58O4 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -80°C |
| InChI | InChI=1S/C40H56O4/c1-29(17-13-19-31(3)21-22-35-36(5,6)25-33(41)27-38(35,9)43)15-11-12-16-30(2)18-14-20-32(4)23-24-40-37(7,8)26-34(42)28-39(40,10)44-40/h11-21,23-24,33-34,41-43H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,24-23+,29-15+,30-16+,31-19+,32-20-/t22?,33-,34-,38+,39+,40-/m0/s1 |
| InChIKey | PGYAYSRVSAJXTE-FTLOKQSXSA-N |
| SMILES | C/C(=C\C=C\C=C(/C)\C=C\C=C(/C)\C=C=C1[C@](C[C@H](CC1(C)C)O)(C)O)/C=C/C=C(/C)\C=C\[C@]23[C@](O2)(C[C@H](CC3(C)C)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |