Neosaxitoxin (Cat. No: T000026) is a derivative of tetrahydropurine. Saxitoxin (STX) is one of the main toxins of paralytic shellfish poison (PSP). STX interferes with the conduction process of neuromuscular by blocking Na + channels, so that the random muscles are relaxed and paralyzed, resulting in a series of toxic symptoms.
| Catalog Number | T000026 |
| CAS Number | 64296-20-4 |
| Synonyms | Neosaxitoxin; NeoSTX |
| Molecular Formula | C10H17N7O5 |
| Purity | 95% |
| Storage | 2-8°C |
| IUPAC Name | [(3aS,4R,10aS)-2-amino-5,10,10-trihydroxy-6-imino-3a,4,8,9-tetrahydro-3H-pyrrolo[1,2-c]purin-4-yl]methyl carbamate |
| InChI | InChI=1S/C10H17N7O5/c11-6-14-5-4(3-22-8(13)18)17(21)7(12)16-2-1-9(19,20)10(5,16)15-6/h4-5,12,19-21H,1-3H2,(H2,13,18)(H3,11,14,15)/t4-,5-,10-/m0/s1 |
| InChIKey | PPEKGEBBBBNZKS-HGRQIUPRSA-N |
| SMILES | C1CN2C(=N)N(C(C3C2(C1(O)O)N=C(N3)N)COC(=O)N)O |
| Reference | 1: Rodriguez-Navarro AJ, Lagos N, Lagos M, Braghetto I, Csendes A, Hamilton J, Figueroa C, Truan D, Garcia C, Rojas A, Iglesias V, Brunet L, Alvarez F. Neosaxitoxin as a local anesthetic: preliminary observations from a first human trial. Anesthesiology. 2007 Feb;106(2):339-45. PubMed PMID: 17264729.<br /> |
