For research use only. Not for therapeutic Use.
Neoponcirin(Cat No.: R042061) is a flavonoid glycoside found in plants, particularly in the genus Ponciris. It exhibits a range of potential biological activities, including antioxidant, anti-inflammatory, and anticancer effects. Studies suggest that neoponcirin may help modulate signaling pathways related to oxidative stress and inflammation, potentially offering therapeutic benefits in conditions such as cancer, cardiovascular disease, and metabolic disorders. Its ability to inhibit tumor growth and reduce inflammation has attracted scientific interest, though further research is needed to understand its full pharmacological potential.
| CAS Number | 14259-47-3 |
| Synonyms | (2S)-7-[[6-O-(6-deoxy-α-L-mannopyranosyl)-β-D-glucopyranosyl]oxy]-2,3-dihydro-5-hydroxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one; Didymin; 4’-Methoxy-5,7-dihydroxyflavanone 7-O-rutinoside; Didymine; Isosakuranetin 7-O-Rutinoside; Isosakuranetin 7-Ru |
| Molecular Formula | C28H34O14 |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | (2S)-5-hydroxy-2-(4-methoxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C28H34O14/c1-11-21(31)23(33)25(35)27(39-11)38-10-19-22(32)24(34)26(36)28(42-19)40-14-7-15(29)20-16(30)9-17(41-18(20)8-14)12-3-5-13(37-2)6-4-12/h3-8,11,17,19,21-29,31-36H,9-10H2,1-2H3/t11-,17-,19+,21-,22+,23+,24-,25+,26+,27+,28+/m0/s1 |
| InChIKey | RMCRQBAILCLJGU-HIBKWJPLSA-N |
| SMILES | CC1C(C(C(C(O1)OCC2C(C(C(C(O2)OC3=CC(=C4C(=O)CC(OC4=C3)C5=CC=C(C=C5)OC)O)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |