For research use only. Not for therapeutic Use.
Neophytadiene（Cat No.:R008999）is a naturally occurring diterpene hydrocarbon found in various medicinal plants, including Ocimum sanctum (holy basil), Moringa oleifera, and certain marine algae. It exists in two isomeric forms (E and Z) and is recognized for its diverse biological activities, including anti-inflammatory, antioxidant, antimicrobial, and insecticidal effects. Neophytadiene contributes to the therapeutic properties of plant extracts and is also studied for its role in plant defense and signaling. Its presence in essential oils and extracts supports its potential in pharmaceuticals, nutraceuticals, and natural pesticide development. Research continues to explore its medicinal value.
| CAS Number | 504-96-1 |
| Synonyms | 7,11,15-trimethyl-3-methylidenehexadec-1-ene |
| Molecular Formula | C20H38 |
| Purity | ≥95% |
| IUPAC Name | 7,11,15-trimethyl-3-methylidenehexadec-1-ene |
| InChI | InChI=1S/C20H38/c1-7-18(4)12-9-14-20(6)16-10-15-19(5)13-8-11-17(2)3/h7,17,19-20H,1,4,8-16H2,2-3,5-6H3 |
| InChIKey | NIDGCIPAMWNKOA-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(=C)C=C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
