For research use only. Not for therapeutic Use.
Neoliquiritin（Cat No.:R072625）is a natural flavonoid glycoside isolated from licorice (Glycyrrhiza species), a plant long used in traditional medicine. Structurally, it is related to liquiritin and contains a flavanone backbone linked to a glucose moiety. Neoliquiritin exhibits diverse pharmacological effects, including antioxidant, anti-inflammatory, neuroprotective, and antidepressant-like activities. It modulates signaling pathways such as NF-κB and MAPK, reducing oxidative stress and inflammatory cytokine production. Preclinical studies suggest its potential in managing mood disorders, neurodegeneration, and inflammation. As a bioactive compound, neoliquiritin is a valuable candidate for pharmacological and therapeutic research.
| CAS Number | 5088-75-5 |
| Synonyms | (2S)-2-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| Molecular Formula | C21H22O9 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-(4-hydroxyphenyl)-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3-dihydrochromen-4-one |
| InChI | InChI=1S/C21H22O9/c22-9-17-18(25)19(26)20(27)21(30-17)28-12-5-6-13-14(24)8-15(29-16(13)7-12)10-1-3-11(23)4-2-10/h1-7,15,17-23,25-27H,8-9H2/t15-,17+,18+,19-,20+,21+/m0/s1 |
| InChIKey | HJBUYKZTEBZNSH-ZRWXNEIDSA-N |
| SMILES | C1[C@H](OC2=C(C1=O)C=CC(=C2)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)C4=CC=C(C=C4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
