For research use only. Not for therapeutic Use.
Neolancerin（Cat No.:I044844）is a bioactive sesquiterpene lactone isolated from plants in the Inula or Laggera genera, known for their use in traditional medicine. It features a guaianolide-type skeleton with a fused lactone ring and multiple functional groups, contributing to its pharmacological activity. Neolancerin has demonstrated anti-inflammatory, antimicrobial, and cytotoxic effects, likely through inhibition of NF-κB signaling and induction of apoptosis in cancer cells. Its ability to modulate key molecular pathways makes it a promising candidate for drug development in oncology and inflammation-related conditions. Further research is ongoing to explore its therapeutic potential.
| CAS Number | 117221-65-5 |
| Synonyms | 1,3,7-trihydroxy-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthen-9-one |
| Molecular Formula | C19H18O10 |
| Purity | ≥95% |
| IUPAC Name | 1,3,7-trihydroxy-2-[(2S,3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]xanthen-9-one |
| InChI | InChI=1S/C19H18O10/c20-5-11-15(24)17(26)18(27)19(29-11)12-8(22)4-10-13(16(12)25)14(23)7-3-6(21)1-2-9(7)28-10/h1-4,11,15,17-22,24-27H,5H2/t11-,15-,17+,18-,19+/m1/s1 |
| InChIKey | KRCBALDMBZQTIQ-ZJKJAXBQSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=O)C3=C(O2)C=C(C(=C3O)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
