For research use only. Not for therapeutic Use.
Neobavaisoflavone(Cat No.:I003495) is a flavonoid compound that is derived from the seeds of Psoralea corylifolia. It possesses various beneficial effects, including anti-inflammatory, anticancer, and antioxidant properties. Neobavaisoflavone can inhibit DNA polymerase at moderate to high concentrations and also exhibits inhibitory effects on platelet aggregation. These properties make it a potentially valuable compound in the development of therapeutic agents for conditions related to inflammation, cancer, oxidative stress, and platelet dysfunction.
| CAS Number | 41060-15-5 |
| Synonyms | 7-hydroxy-3-[4-hydroxy-3-(3-methyl-2-buten-1-yl)phenyl]-4H-1-benzopyran-4-one |
| Molecular Formula | C20H18O4 |
| Purity | ≥95% |
| Target | Cell Cycle/DNA Damage |
| Solubility | DMSO: ≥ 31 mg/mL |
| Storage | under inert gas (nitrogen or Argon) at 2-8°C |
| IC50 | 42.93 μM (toward CCRF-CEM cells); 114.64 μM [against HCT116 (p53(+/+)) cells] [2] |
| IUPAC Name | 7-hydroxy-3-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]chromen-4-one |
| InChI | InChI=1S/C20H18O4/c1-12(2)3-4-14-9-13(5-8-18(14)22)17-11-24-19-10-15(21)6-7-16(19)20(17)23/h3,5-11,21-22H,4H2,1-2H3 |
| InChIKey | OBGPEBYHGIUFBN-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C=CC(=C1)C2=COC3=C(C2=O)C=CC(=C3)O)O)C |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |