For research use only. Not for therapeutic Use.
Neoanhydropodophyllol(Cat No.:I044890)is a naturally occurring aryltetralin lignan structurally related to podophyllotoxin, typically isolated from Podophyllum species. It features a polycyclic framework with characteristic oxygenated substituents, contributing to its bioactivity. Neoanhydropodophyllol exhibits cytotoxic and antiproliferative effects by interfering with microtubule assembly, making it of interest in anticancer drug research. While less studied than podophyllotoxin, it serves as a valuable intermediate or lead compound for the development of semisynthetic derivatives. Its potential pharmacological applications include anticancer, antiviral, and anti-inflammatory therapies in both natural product and medicinal chemistry research.
CAS Number | 62287-47-2 |
Synonyms | [(1R,11R,12R,15R)-11-(3,4,5-trimethoxyphenyl)-5,7,14-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-trien-15-yl]methanol |
Molecular Formula | C22H24O7 |
Purity | ≥95% |
IUPAC Name | [(1R,11R,12R,15R)-11-(3,4,5-trimethoxyphenyl)-5,7,14-trioxatetracyclo[10.2.1.02,10.04,8]pentadeca-2,4(8),9-trien-15-yl]methanol |
InChI | InChI=1S/C22H24O7/c1-24-18-4-11(5-19(25-2)22(18)26-3)20-12-6-16-17(29-10-28-16)7-13(12)21-14(8-23)15(20)9-27-21/h4-7,14-15,20-21,23H,8-10H2,1-3H3/t14-,15-,20+,21-/m0/s1 |
InChIKey | GAPFRQMOPFLDIS-YJPXFSGGSA-N |
SMILES | COC1=CC(=CC(=C1OC)OC)[C@H]2[C@H]3CO[C@H]([C@H]3CO)C4=CC5=C(C=C24)OCO5 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |