For research use only. Not for therapeutic Use.
Neoamygdalin（Cat No.:I033160）is a compound derived from the seeds of certain fruits, such as apricots, and is chemically similar to amygdalin, a substance often associated with cyanogenic glycosides. It has been studied for its potential therapeutic effects, particularly in cancer research, as it has been proposed to release cyanide in the body under certain conditions, targeting tumor cells. While its anticancer properties are debated, neoamygdalin is explored in research for its role in modulating cell death, apoptosis, and metabolic pathways, with ongoing investigations into its efficacy and safety in medical treatments.
| CAS Number | 29883-16-7 |
| Synonyms | (2S)-2-phenyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyacetonitrile |
| Molecular Formula | C20H27NO11 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-phenyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxyacetonitrile |
| InChI | InChI=1S/C20H27NO11/c21-6-10(9-4-2-1-3-5-9)30-20-18(28)16(26)14(24)12(32-20)8-29-19-17(27)15(25)13(23)11(7-22)31-19/h1-5,10-20,22-28H,7-8H2/t10-,11-,12-,13-,14-,15+,16+,17-,18-,19-,20-/m1/s1 |
| InChIKey | XUCIJNAGGSZNQT-UUGBRMIUSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C#N)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
