For research use only. Not for therapeutic Use.
NDB (Cat No.:I044097) typically refers to a class of compounds that target NADH:ubiquinone oxidoreductase (Complex I) of the mitochondrial electron transport chain. By inhibiting Complex I, NDB compounds disrupt oxidative phosphorylation, reduce ATP production, and increase reactive oxygen species (ROS), making them valuable in studying mitochondrial dysfunction, cancer metabolism, and neurodegenerative diseases. NDB compounds are also used to explore redox homeostasis and mitochondria-targeted therapeutics. Their applications span cellular respiration studies, metabolic profiling, and apoptosis regulation.
| CAS Number | 1660153-08-1 |
| Synonyms | N-benzyl-N-(3-tert-butyl-4-hydroxyphenyl)-2,6-dichloro-4-(dimethylamino)benzamide |
| Molecular Formula | C26H28Cl2N2O2 |
| Purity | ≥95% |
| IUPAC Name | N-benzyl-N-(3-tert-butyl-4-hydroxyphenyl)-2,6-dichloro-4-(dimethylamino)benzamide |
| InChI | InChI=1S/C26H28Cl2N2O2/c1-26(2,3)20-13-18(11-12-23(20)31)30(16-17-9-7-6-8-10-17)25(32)24-21(27)14-19(29(4)5)15-22(24)28/h6-15,31H,16H2,1-5H3 |
| InChIKey | IDACWMHIKWNAEO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=C(C=CC(=C1)N(CC2=CC=CC=C2)C(=O)C3=C(C=C(C=C3Cl)N(C)C)Cl)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
