For research use only. Not for therapeutic Use.
NCI-B16(CAT: I040567) is a small-molecule RNA binder with demonstrated antiviral activity, particularly against hepatitis C virus (HCV). By selectively binding to structured RNA elements within the HCV genome, NCI-B16 interferes with viral replication processes, leading to a significant reduction in viral RNA levels. Its mechanism targets critical RNA motifs essential for viral translation and replication, making it a valuable tool for studying RNA–ligand interactions and antiviral RNA-targeted strategies. NCI-B16 offers potential as a lead compound for the development of novel therapeutics aimed at RNA viruses and supports research into structure-based RNA drug design in virology and infectious disease models.
| CAS Number | 802835-01-4 |
| Synonyms | 3,5-bis[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]carbamoylamino]benzoic acid |
| Molecular Formula | C27H26N8O4 |
| Purity | ≥95% |
| IUPAC Name | 3,5-bis[[4-(4,5-dihydro-1H-imidazol-2-yl)phenyl]carbamoylamino]benzoic acid |
| InChI | InChI=1S/C27H26N8O4/c36-25(37)18-13-21(34-26(38)32-19-5-1-16(2-6-19)23-28-9-10-29-23)15-22(14-18)35-27(39)33-20-7-3-17(4-8-20)24-30-11-12-31-24/h1-8,13-15H,9-12H2,(H,28,29)(H,30,31)(H,36,37)(H2,32,34,38)(H2,33,35,39) |
| InChIKey | PQQQHHNCTCOPJD-UHFFFAOYSA-N |
| SMILES | C1CN=C(N1)C2=CC=C(C=C2)NC(=O)NC3=CC(=CC(=C3)C(=O)O)NC(=O)NC4=CC=C(C=C4)C5=NCCN5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
