For research use only. Not for therapeutic Use.
NCGC00262650（Cat No.:I033104）is a small molecule compound identified through high-throughput screening, primarily studied for its potential as a therapeutic agent in treating diseases such as cancer and neurodegenerative disorders. It works by modulating specific biological pathways, potentially inhibiting enzymes or receptors involved in disease progression. NCGC00262650 has shown promise in preclinical research, demonstrating its ability to target molecular processes essential for cell survival, proliferation, or inflammation. Its specificity and mechanism of action make it a valuable candidate for further investigation in drug development, offering potential applications in targeted therapies.
| CAS Number | 344359-25-7 |
| Synonyms | 7-cyclopentyl-5-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| Molecular Formula | C18H20N4O |
| Purity | ≥95% |
| IUPAC Name | 7-cyclopentyl-5-(4-methoxyphenyl)pyrrolo[2,3-d]pyrimidin-4-amine |
| InChI | InChI=1S/C18H20N4O/c1-23-14-8-6-12(7-9-14)15-10-22(13-4-2-3-5-13)18-16(15)17(19)20-11-21-18/h6-11,13H,2-5H2,1H3,(H2,19,20,21) |
| InChIKey | BRUSFAZPHIPJRR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CN(C3=NC=NC(=C23)N)C4CCCC4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
