For research use only. Not for therapeutic Use.
Navamepent（Cat No.:I008243）is a selective antagonist of the TRPM8 (Transient Receptor Potential Melastatin 8) ion channel, which is primarily responsible for sensing cold and menthol stimuli. By blocking TRPM8 activity, Navamepent has shown potential in alleviating cold-induced pain and hypersensitivity, making it a promising candidate for neuropathic pain research. It is particularly useful in studying sensory neuron modulation, thermoregulation, and pain signaling pathways. Navamepent is being explored as a non-opioid analgesic alternative.
| CAS Number | 1251537-11-7 |
| Synonyms | propan-2-yl (5S,8E,10E,12R)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate |
| Molecular Formula | C18H24O4 |
| Purity | ≥95% |
| IUPAC Name | propan-2-yl (5S,8E,10E,12R)-5,12-dihydroxypentadeca-8,10-dien-6,14-diynoate |
| InChI | InChI=1S/C18H24O4/c1-4-10-16(19)11-7-5-6-8-12-17(20)13-9-14-18(21)22-15(2)3/h1,5-7,11,15-17,19-20H,9-10,13-14H2,2-3H3/b6-5+,11-7+/t16-,17-/m1/s1 |
| InChIKey | ZVOCIIHCJJEFRQ-BHXBHYJPSA-N |
| SMILES | CC(C)OC(=O)CCC[C@@H](C#C/C=C/C=C/[C@@H](CC#C)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
