For research use only. Not for therapeutic Use.
NAT (Cat No.:I044041) refers to a family of enzymes, particularly arylamine N-acetyltransferases (NAT1 and NAT2), that catalyze the acetylation of arylamine and hydrazine substrates. These enzymes play a key role in xenobiotic metabolism, influencing the detoxification or activation of drugs, carcinogens, and environmental toxins. NAT polymorphisms significantly affect individual responses to medications and susceptibility to certain cancers, particularly bladder and colorectal cancers. NAT is a valuable research target in pharmacogenomics and toxicology, helping to explore metabolic variability, drug efficacy, and adverse reactions based on genetic acetylator status in diverse populations.
| CAS Number | 831243-31-3 |
| Synonyms | 2-(2-tert-butylphenoxy)-N-(4-hydroxyphenyl)acetamide |
| Molecular Formula | C18H21NO3 |
| Purity | ≥95% |
| IUPAC Name | 2-(2-tert-butylphenoxy)-N-(4-hydroxyphenyl)acetamide |
| InChI | InChI=1S/C18H21NO3/c1-18(2,3)15-6-4-5-7-16(15)22-12-17(21)19-13-8-10-14(20)11-9-13/h4-11,20H,12H2,1-3H3,(H,19,21) |
| InChIKey | RUNXUUCDTNJFME-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=CC=C1OCC(=O)NC2=CC=C(C=C2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
