For research use only. Not for therapeutic Use.
Naphthofluorescein(Cat No.:R063595)is a xanthene-based fluorescent dye known for its red emission and pH-sensitive properties. Structurally related to fluorescein, it exhibits strong fluorescence in alkaline environments, making it useful for tracking pH changes in biological systems. Its large Stokes shift and emission in the red spectrum reduce background autofluorescence, enhancing imaging clarity. Naphthofluorescein is widely used in fluorescence microscopy, flow cytometry, and intracellular pH assays. Additionally, it serves as a probe in drug delivery and cell permeability studies, particularly when high sensitivity and low background fluorescence are essential.
CAS Number | 61419-02-1 |
Synonyms | 7′,19′-dihydroxyspiro[2-benzofuran-3,13′-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaene]-1-one |
Molecular Formula | C28H16O5 |
Purity | ≥95% |
IUPAC Name | 7',19'-dihydroxyspiro[2-benzofuran-3,13'-2-oxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(14),3(12),4(9),5,7,10,15,17(22),18,20-decaene]-1-one |
InChI | InChI=1S/C28H16O5/c29-17-7-9-19-15(13-17)5-11-23-25(19)32-26-20-10-8-18(30)14-16(20)6-12-24(26)28(23)22-4-2-1-3-21(22)27(31)33-28/h1-14,29-30H |
InChIKey | IXQIUDNVFVTQLJ-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(=O)OC23C4=C(C5=C(C=C4)C=C(C=C5)O)OC6=C3C=CC7=C6C=CC(=C7)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |