Naltrexone HCl (CAS16676-29-2) is an opioid receptor antagonist used primarily in the management of alcohol dependence and opioid dependence. Naltrexone (0.32 mg/kg) reduces ethanol-reinforced responding at the concentration that maintained the most responding (1% or 2%) in rhesus monkeys. Naltrexone (0.1 mg/kg) reduces ethanol-reinforced responding, both at a low ethanol concentration (0.25%) that produced little ethanol intake (g/kg), and at a higher concentration (4%) with an appreciable intake.
| Catalog Number | A001156 |
| CAS Number | 16676-29-2 |
| Synonyms | NA |
| Molecular Formula | C20H23NO4 • HCl |
| Purity | ≥95% |
| Target | opioid receptor |
| Storage | 3 years -20C powder |
| IUPAC Name | (4R,4aS,7aR,12bS)-3-(cyclopropylmethyl)-4a,9-dihydroxy-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinolin-7-one;hydrochloride |
| InChI | InChI=1S/C20H23NO4.ClH/c22-13-4-3-12-9-15-20(24)6-5-14(23)18-19(20,16(12)17(13)25-18)7-8-21(15)10-11-1-2-11;/h3-4,11,15,18,22,24H,1-2,5-10H2;1H/t15-,18+,19+,20-;/m1./s1 |
| InChIKey | RHBRMCOKKKZVRY-ITLPAZOVSA-N |
| SMILES | C1CC1CN2CCC34C5C(=O)CCC3(C2CC6=C4C(=C(C=C6)O)O5)O.Cl |
