For research use only. Not for therapeutic Use.
N8-Desethylcarbamoyl-N1-ethylcarbamoyl cabergoline is a modified derivative of cabergoline, a dopamine receptor agonist used to treat hyperprolactinemia and related disorders. This compound features ethylcarbamoyl groups at the N1 and N8 positions, altering its pharmacological properties compared to cabergoline. Research on N8-Desethylcarbamoyl-N1-ethylcarbamoyl cabergoline aims to evaluate its efficacy and safety in managing hyperprolactinemia and explore potential applications in other neurological or endocrine conditions. It represents a novel modification of cabergoline with potential therapeutic benefits.
| CAS Number | 166533-36-4 |
| Synonyms | (8β)-N8-[3-(Dimethylamino)propyl]-N1-ethyl-6-(2-propen-1-yl)-ergoline-1,8-dicarboxamide; (8β)-N8-[3-(Dimethylamino)propyl]-N1-ethyl-6-(2-propenyl)-ergoline-1,8-dicarboxamide; Cabergoline EP Impurity B |
| Molecular Formula | C26H37N5O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (6aR,9R,10aR)-9-N-[3-(dimethylamino)propyl]-4-N-ethyl-7-prop-2-enyl-6,6a,8,9,10,10a-hexahydroindolo[4,3-fg]quinoline-4,9-dicarboxamide |
| InChI | InChI=1S/C26H37N5O2/c1-5-12-30-16-19(25(32)28-11-8-13-29(3)4)14-21-20-9-7-10-22-24(20)18(15-23(21)30)17-31(22)26(33)27-6-2/h5,7,9-10,17,19,21,23H,1,6,8,11-16H2,2-4H3,(H,27,33)(H,28,32)/t19-,21-,23-/m1/s1 |
| InChIKey | IRQIOIBAVPLXLF-KJXAQDMKSA-N |
| SMILES | CCNC(=O)N1C=C2CC3C(CC(CN3CC=C)C(=O)NCCCN(C)C)C4=C2C1=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |