For research use only. Not for therapeutic Use.
N,2,5-Trimethylaniline(Cat No.:L007590), is a chemical compound featuring an aniline core with three methyl groups attached at the N-position, providing a distinctive molecular structure. This compound is essential in organic synthesis and is employed as a building block for various complex molecules. Its reactivity and versatility make it valuable in the production of dyes, pharmaceuticals, and agrochemicals. Researchers also use it as a reagent in chemical reactions, owing to its stability and compatibility. The compound’s unique structure facilitates diverse chemical modifications, contributing significantly to advancements in the fields of organic chemistry and industrial applications.
| CAS Number | 21354-48-3 |
| Molecular Formula | C9H13N |
| Purity | ≥95% |
| IUPAC Name | N,2,5-trimethylaniline |
| InChI | InChI=1S/C9H13N/c1-7-4-5-8(2)9(6-7)10-3/h4-6,10H,1-3H3 |
| InChIKey | FLLXIDNFXBLBMT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)NC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |