For research use only. Not for therapeutic Use.
N1-(4-bromophenyl)-1,2-benzenediamine (Cat.No:L003339) is a crucial chemical compound in pharmaceutical research. Its distinctive structure and reactivity make it a valuable scaffold for the development of novel pharmaceutical agents, underscoring its importance in modern drug discovery.
| CAS Number | 100953-52-4 |
| Molecular Formula | C12H11BrN2 |
| Purity | ≥95% |
| IUPAC Name | 2-N-(4-bromophenyl)benzene-1,2-diamine |
| InChI | InChI=1S/C12H11BrN2/c13-9-5-7-10(8-6-9)15-12-4-2-1-3-11(12)14/h1-8,15H,14H2 |
| InChIKey | LCLAHXCIHJAZIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)NC2=CC=C(C=C2)Br |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |