For research use only. Not for therapeutic Use.
N-Vanillyloctanamide(Cat No.:M014890)is a synthetic compound derived from vanillin, the primary component of vanilla extract, and octanoic acid. Known for its vanilloid receptor agonist properties, it mimics the heat sensation of capsaicin but with a milder and longer-lasting effect. This makes it valuable in topical analgesic formulations for pain relief and as a warming agent in personal care products. Additionally, N-Vanillyloctanamide is used in food flavoring and as an active ingredient in sports creams and cosmetics. Its dual role in sensory modulation and therapeutic applications highlights its versatility and importance in various industries.
| CAS Number | 58493-47-3 |
| Synonyms | N-VANILLYLOCTANAMIDE |
| Molecular Formula | C16H25NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-[(4-hydroxy-3-methoxyphenyl)methyl]octanamide |
| InChI | InChI=1S/C16H25NO3/c1-3-4-5-6-7-8-16(19)17-12-13-9-10-14(18)15(11-13)20-2/h9-11,18H,3-8,12H2,1-2H3,(H,17,19) |
| InChIKey | JYZDUDMWJFJCON-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(=O)NCC1=CC(=C(C=C1)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |