For research use only. Not for therapeutic Use.
N-Succinimidyl p-formylbenzoate(CAT: R000698) is a chemical compound used in bioconjugation and protein labeling applications. Its mode of action and pharmacological effects involve its interactions with amino groups in biomolecules, such as proteins or peptides, leading to the formation of stable covalent linkages. Pharmacologically, N-Succinimidyl p-formylbenzoate is used to introduce a formylbenzoate moiety onto biomolecules, facilitating subsequent reactions or immobilization onto surfaces for various research and biotechnological purposes. Its applications extend to protein-protein interaction studies, drug delivery systems, and diagnostics, contributing to the development of advanced analytical techniques and biofunctionalized materials.
CAS Number | 60444-78-2 |
Synonyms | 4-Carboxybenzaldehyde N-Hydroxysuccinimide Ester; 4-[[(2,5-Dioxo-1-pyrrolidinyl)oxy]carbonyl]benzaldehyde;?SFB |
Molecular Formula | C12H9NO5 |
Purity | ≥95% |
Target | ADC Linker |
Storage | Store at RT |
IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-formylbenzoate |
InChI | InChI=1S/C12H9NO5/c14-7-8-1-3-9(4-2-8)12(17)18-13-10(15)5-6-11(13)16/h1-4,7H,5-6H2 |
InChIKey | VHYRHFNOWKMCHQ-UHFFFAOYSA-N |
SMILES | C1CC(=O)N(C1=O)OC(=O)C2=CC=C(C=C2)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |