Home
>
Chemical Reagents>Heterocyclic Building Blocks> N-(pyridin-2-ylmethyl)acetamide hydrochloride
For research use only. Not for therapeutic Use.
N-(pyridin-2-ylmethyl)acetamide hydrochloride(Cat No.:L007710), is a chemical compound containing an acetamide core with a pyridin-2-ylmethyl group attached to the nitrogen atom. This specific structure is crucial in medicinal chemistry and organic synthesis. Researchers employ it as a key intermediate for the development of various organic compounds, especially in pharmaceutical research. Its applications extend to the synthesis of potential drug candidates and molecular probes.
CAS Number | 1170528-07-0 |
Molecular Formula | C8H11ClN2O |
Purity | ≥95% |
IUPAC Name | N-(pyridin-2-ylmethyl)acetamide;hydrochloride |
InChI | InChI=1S/C8H10N2O.ClH/c1-7(11)10-6-8-4-2-3-5-9-8;/h2-5H,6H2,1H3,(H,10,11);1H |
InChIKey | BRECTPXCYBQPQO-UHFFFAOYSA-N |
SMILES | CC(=O)NCC1=CC=CC=N1.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |