For research use only. Not for therapeutic Use.
N-Phenylsuccinimide(CAT: L045526) is an aromatic imide compound formed by the substitution of one nitrogen atom in succinimide with a phenyl group. This molecule features a five-membered cyclic imide core known for its thermal and chemical stability, combined with the lipophilic and electron-rich properties of the phenyl ring. N-Phenylsuccinimide is commonly used as a synthetic intermediate in pharmaceuticals, agrochemicals, and materials science. It serves as a precursor for the development of anticonvulsant and CNS-active agents, and its imide functionality supports nucleophilic substitution and ring-opening reactions. Its stability and reactivity make it a valuable building block in heterocyclic and medicinal chemistry research.
| CAS Number | 83-25-0 |
| Molecular Formula | C10H9NO2 |
| Purity | ≥95% |
| IUPAC Name | 1-phenylpyrrolidine-2,5-dione |
| InChI | InChI=1S/C10H9NO2/c12-9-6-7-10(13)11(9)8-4-2-1-3-5-8/h1-5H,6-7H2 |
| InChIKey | ZTUKZULGOCFJET-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
