For research use only. Not for therapeutic Use.
N-p-Coumaroyltyramine (Cat.No:R014884) is a natural compound found in various plants. It belongs to the class of hydroxycinnamic acid amides. N-p-Coumaroyltyramine possesses antioxidant and potential neuroprotective properties. Research suggests its involvement in plant defense mechanisms and its potential in various health-related applications, including neurodegenerative disease research.
CAS Number | 36417-86-4 |
Molecular Formula | C17H17NO3 |
Purity | ≥95% |
Target | Anti-infection |
Storage | Store at -20°C |
IUPAC Name | (E)-3-(4-hydroxyphenyl)-N-[2-(4-hydroxyphenyl)ethyl]prop-2-enamide |
InChI | InChI=1S/C17H17NO3/c19-15-6-1-13(2-7-15)5-10-17(21)18-12-11-14-3-8-16(20)9-4-14/h1-10,19-20H,11-12H2,(H,18,21)/b10-5+ |
InChIKey | RXGUTQNKCXHALN-BJMVGYQFSA-N |
SMILES | C1=CC(=CC=C1CCNC(=O)C=CC2=CC=C(C=C2)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |