For research use only. Not for therapeutic Use.
N-Nitrosodimethylamine (NDMA) is a highly toxic and carcinogenic compound with the formula C2H6N2O. It forms as a byproduct in industrial processes and can contaminate water, food, and pharmaceuticals. NDMA is a potent environmental pollutant, prompting regulatory measures to limit its presence. It is studied for its health impacts and the development of methods for its detection and removal.
| CAS Number | 62-75-9 |
| Synonyms | N-Nitrosodi-N-methylamine; Dimethylnitrosamine; NDMA; NSC 23226; |
| Molecular Formula | C2H6N2O |
| Purity | ≥95% |
| Storage | -20 ℃ |
| IUPAC Name | N,N-dimethylnitrous amide |
| InChI | InChI=1S/C2H6N2O/c1-4(2)3-5/h1-2H3 |
| InChIKey | UMFJAHHVKNCGLG-UHFFFAOYSA-N |
| SMILES | CN(C)N=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |