N-Nitroso-N-methyl-4-aminobutyric acid (NMBA) is a nitrosamine compound that is part of the class of N-nitroso compounds, which are known for their potential carcinogenicity. NMBA can form as a byproduct during certain industrial processes, or in the body under certain conditions, particularly in the presence of nitrites and amines. Nitrosamines like NMBA have been linked to increased cancer risk in laboratory studies, especially in the liver, kidneys, and gastrointestinal tract. Due to its toxic and carcinogenic properties, NMBA is closely monitored in food safety and pharmaceutical manufacturing to limit human exposure. Its presence has raised concerns in drug recalls and regulatory efforts to minimize contamination.
Catalog Number | R000499 |
CAS Number | 61445-55-4 |
Synonyms | 4-(Methylnitrosoamino)butanoic Acid; N-Methyl-N-(3-carboxypropyl)nitrosamine ; NMBA; |
Molecular Formula | C5H10N2O3 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-[methyl(nitroso)amino]butanoic acid |
InChI | InChI=1S/C5H10N2O3/c1-7(6-10)4-2-3-5(8)9/h2-4H2,1H3,(H,8,9) |
InChIKey | SJLBIPLIGYWGJV-UHFFFAOYSA-N |
SMILES | CN(CCCC(=O)O)N=O |