For research use only. Not for therapeutic Use.
N-Methyliminodiacetic acid(CAT: I041025) is an amino acid derivative used primarily in the synthesis of metal chelating agents, particularly for coordinating metal ions in various applications. Its structure features an iminodiacetic acid backbone with a methyl group, enhancing its ability to bind with metals like copper, nickel, and cobalt. This compound is essential in the development of ligands for catalysis, particularly in metal-catalyzed reactions. It is also utilized in pharmaceutical research for its potential to aid in drug delivery systems by forming stable complexes with therapeutic metals, enhancing their bioavailability and targeting specific tissues or cells.
CAS Number | 4408-64-4 |
Synonyms | 2-[carboxymethyl(methyl)amino]acetic acid |
Molecular Formula | C5H9NO4 |
Purity | ≥95% |
IUPAC Name | 2-[carboxymethyl(methyl)amino]acetic acid |
InChI | InChI=1S/C5H9NO4/c1-6(2-4(7)8)3-5(9)10/h2-3H2,1H3,(H,7,8)(H,9,10) |
InChIKey | XWSGEVNYFYKXCP-UHFFFAOYSA-N |
SMILES | CN(CC(=O)O)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |