For research use only. Not for therapeutic Use.
N-Methyl-N-formylhydrazine (Cat.No:R045444) is a chemical compound used in the synthesis of pharmaceuticals and agrochemicals. Its hydrazine moiety makes it valuable for creating diverse molecules. As a versatile reagent, it contributes to the development of various organic compounds, playing a pivotal role in medicinal and chemical research.
| CAS Number | 758-17-8 |
| Synonyms | 1-Formyl-1-methylhydrazine; 1-Methyl-1-formylhydrazide; 2-Methyl-2-formylhydrazine; N-Formyl-N-methylhydrazine; Formic Acid 1-Methylhydrazide; 1-Methylhydrazinecarboxaldehyde; |
| Molecular Formula | C2H6N2O |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | N-amino-N-methylformamide |
| InChI | InChI=1S/C2H6N2O/c1-4(3)2-5/h2H,3H2,1H3 |
| InChIKey | RSFOTOSOKJMMCB-UHFFFAOYSA-N |
| SMILES | CN(C=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
