For research use only, not for therapeutic use.
N-Methyl-3,5-dichlorobenzylamine(Cat No.:L006783). It consists of a benzylamine backbone with methyl substitution at the nitrogen atom and chlorine atoms at the 3- and 5-positions of the phenyl ring. This compound is used as a valuable intermediate in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. Its unique structure allows for diverse chemical transformations, making it essential in the creation of complex molecules.
Catalog Number | L006783 |
CAS Number | 90390-21-9 |
Molecular Formula | C8H9Cl2N |
Purity | ≥95% |
IUPAC Name | 1-(3,5-dichlorophenyl)-N-methylmethanamine |
InChI | InChI=1S/C8H9Cl2N/c1-11-5-6-2-7(9)4-8(10)3-6/h2-4,11H,5H2,1H3 |
InChIKey | SSTJQZMMDIIKBR-UHFFFAOYSA-N |
SMILES | CNCC1=CC(=CC(=C1)Cl)Cl |