For research use only. Not for therapeutic Use.
N-Methyl-3,5-dichlorobenzylamine(Cat No.:L006783). It consists of a benzylamine backbone with methyl substitution at the nitrogen atom and chlorine atoms at the 3- and 5-positions of the phenyl ring. This compound is used as a valuable intermediate in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. Its unique structure allows for diverse chemical transformations, making it essential in the creation of complex molecules.
| CAS Number | 90390-21-9 |
| Molecular Formula | C8H9Cl2N |
| Purity | ≥95% |
| IUPAC Name | 1-(3,5-dichlorophenyl)-N-methylmethanamine |
| InChI | InChI=1S/C8H9Cl2N/c1-11-5-6-2-7(9)4-8(10)3-6/h2-4,11H,5H2,1H3 |
| InChIKey | SSTJQZMMDIIKBR-UHFFFAOYSA-N |
| SMILES | CNCC1=CC(=CC(=C1)Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |