For research use only. Not for therapeutic Use.
N-Methoxy-N-methylprop-2-enamide(Cat No.:L007225), is a chemical compound. It features a prop-2-enamide group—a carbonyl-containing compound with an ethylene linkage—substituted with a methoxy group and a methyl group at the nitrogen atom. This compound is notable in organic synthesis and medicinal chemistry research. Its unique structure suggests potential interactions with biological targets, making it valuable for researchers exploring new bioactive molecules. N-Methoxy-N-methylprop-2-enamide is used as a key intermediate in the synthesis of various complex organic compounds, contributing to drug discovery efforts and advancements in medicinal chemistry research.
CAS Number | 193634-77-4 |
Molecular Formula | C5H9NO2 |
Purity | ≥95% |
IUPAC Name | N-methoxy-N-methylprop-2-enamide |
InChI | InChI=1S/C5H9NO2/c1-4-5(7)6(2)8-3/h4H,1H2,2-3H3 |
InChIKey | IAAVEAHABZTBNK-UHFFFAOYSA-N |
SMILES | CN(C(=O)C=C)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |