For research use only. Not for therapeutic Use.
N-(Isobutoxymethyl)acrylamide(Cat No.:M076056), is a chemical compound used in the production of various polymers and as a crosslinking agent in the field of adhesives and coatings. It is a clear liquid with a molecular structure that includes an acrylamide group and an isobutoxymethyl side chain. This compound is valued for its ability to improve the adhesion, flexibility, and durability of polymers and coatings. It is also employed in the manufacture of specialized materials for the electronics and packaging industries.
| CAS Number | 16669-59-3 |
| Molecular Formula | C8H15NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-(2-methylpropoxymethyl)prop-2-enamide |
| InChI | InChI=1S/C8H15NO2/c1-4-8(10)9-6-11-5-7(2)3/h4,7H,1,5-6H2,2-3H3,(H,9,10) |
| InChIKey | KCTMTGOHHMRJHZ-UHFFFAOYSA-N |
| SMILES | CC(C)COCNC(=O)C=C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |