For research use only. Not for therapeutic Use.
N-Fmoc-N-benzyl-L-alanine(Cat No.:I043004)is a derivative of the amino acid L-alanine, featuring a fluorenylmethyloxycarbonyl (Fmoc) protecting group on the nitrogen atom and a benzyl group attached to the side chain nitrogen. This compound is commonly used in peptide synthesis, where the Fmoc group serves as a temporary protecting group for the amino functionality, facilitating the stepwise construction of peptides. The molecular formula is C₂₅H₂₃NO₄, with a molecular weight of 401.46 g/mol. It appears as a white to off-white solid and is soluble in organic solvents like dimethylformamide (DMF) and dichloromethane (DCM). Proper handling and storage in a cool, dry place are essential to maintain its stability and reactivity.
| CAS Number | 672917-68-9 |
| Synonyms | (2S)-2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| Molecular Formula | C25H23NO4 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[benzyl(9H-fluoren-9-ylmethoxycarbonyl)amino]propanoic acid |
| InChI | InChI=1S/C25H23NO4/c1-17(24(27)28)26(15-18-9-3-2-4-10-18)25(29)30-16-23-21-13-7-5-11-19(21)20-12-6-8-14-22(20)23/h2-14,17,23H,15-16H2,1H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | QFVKHZGPQOFFBR-KRWDZBQOSA-N |
| SMILES | C[C@@H](C(=O)O)N(CC1=CC=CC=C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |