For research use only. Not for therapeutic Use.
N-Fmoc-4-piperidinol (Cat No.: L006976) is a crucial compound with diverse roles. Its action involves N-Fmoc protection, safeguarding the piperidinol nitrogen for selective reactivity. The mode of action includes controlled deprotection, allowing the amine group’s exposure. Pharmacologically, it serves as a pivotal building block in organic synthesis, particularly in the field of peptide chemistry. Its applications span peptide coupling, enabling peptide bond formation in solid-phase peptide synthesis. Additionally, it finds use in pharmaceutical research, aiding the creation of peptide-based drugs and mimetics.
CAS Number | 351184-42-4 |
Molecular Formula | C20H21NO3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 9H-fluoren-9-ylmethyl 4-hydroxypiperidine-1-carboxylate |
InChI | InChI=1S/C20H21NO3/c22-14-9-11-21(12-10-14)20(23)24-13-19-17-7-3-1-5-15(17)16-6-2-4-8-18(16)19/h1-8,14,19,22H,9-13H2 |
InChIKey | DANUFRHHXWZNIK-UHFFFAOYSA-N |
SMILES | C1CN(CCC1O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |