For research use only. Not for therapeutic Use.
| CAS Number | 19961-27-4 |
| Synonyms | N-Ethyl-2-propanamine; 1-Methyldiethylamine; (Ethyl)(1-methylethyl)amine; 2-(Ethylamino)propane; Ethylisopropylamine; Isopropylethylamine; N-Ethyl-2-propanamine; N-Ethyl-N-isopropylamine; NSC 165659; |
| Molecular Formula | C5H13N |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | N-ethylpropan-2-amine |
| InChI | InChI=1S/C5H13N/c1-4-6-5(2)3/h5-6H,4H2,1-3H3 |
| InChIKey | RIVIDPPYRINTTH-UHFFFAOYSA-N |
| SMILES | CCNC(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |