For research use only. Not for therapeutic Use.
N-(Diphenylmethylene)glycine ethyl ester (Cat.No:R026393) is a chemical compound used as a reactant in organic synthesis. Its unique structure combines a diphenylmethylene group with a glycine ethyl ester moiety. This compound serves as a valuable building block in creating diverse molecules for pharmaceutical and chemical research applications.
| CAS Number | 69555-14-2 |
| Synonyms | (Benzhydrylideneamino)acetic Acid Ethyl Ester; Ethyl (Benzhydrylideneamino)acetate; Ethyl 2-[(Diphenylmethylene)amino]acetate; Ethyl N-(Diphenylmethylene)glycinate; Ethyl N-Benzhydrylideneglycinate; N-(Diphenylmethylidene)glycine Ethyl Ester; NSC 26 |
| Molecular Formula | C17H17NO2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | ethyl 2-(benzhydrylideneamino)acetate |
| InChI | InChI=1S/C17H17NO2/c1-2-20-16(19)13-18-17(14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3 |
| InChIKey | QUGJYNGNUBHTNS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN=C(C1=CC=CC=C1)C2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
