For research use only. Not for therapeutic Use.
N-cyano-N’, N’-dimethylguanidine(Cat No.:M123925), is a chemical compound used in various chemical and industrial applications. Its chemical structure consists of a guanidine group with two methyl groups and a cyano group attached to the nitrogen atoms. N-cyano-N’, N’-dimethylguanidine is commonly used as a base in chemical reactions to promote condensation, alkylation, and other transformations. Its ability to participate in various reactions makes it valuable in the production of pharmaceuticals, agrochemicals, and specialty chemicals.
| CAS Number | 1609-06-9 |
| Molecular Formula | C4H8N4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-cyano-1,1-dimethylguanidine |
| InChI | InChI=1S/C4H8N4/c1-8(2)4(6)7-3-5/h1-2H3,(H2,6,7) |
| InChIKey | TUYAIZHPVZJKIN-UHFFFAOYSA-N |
| SMILES | CN(C)C(=NC#N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |