For research use only. Not for therapeutic Use.
N-Boc-piperazine-d8 is a deuterated derivative of N-Boc-piperazine, featuring eight deuterium atoms that enhance its stability and analytical precision. The compound is widely used in pharmaceutical and organic chemistry research to study reaction mechanisms and metabolic pathways using techniques like NMR and mass spectrometry. It serves as a valuable intermediate in the synthesis of piperazine-based compounds and pharmaceuticals. The deuterium labeling allows for detailed tracking of molecular interactions and transformations, providing insights into drug development processes and the behavior of piperazine derivatives in various chemical environments.
CAS Number | 1126621-86-0 |
Synonyms | 1-(tert-Butoxycarbonyl)piperazine-d8; 1-(Piperazine-d8)carboxylic Acid 1,1-Dimethylethyl Ester; tert-Butyl 1-(Piperazine-d8)carboxylate; 1-[(1,1-Dimethylethoxy)carbonyl]piperazine-d8; 1-(Piperazine-d8)carboxylic Acid tert-Butyl Ester; |
Molecular Formula | C₉H₁₀D₈N₂O₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | tert-butyl 2,2,3,3,5,5,6,6-octadeuteriopiperazine-1-carboxylate |
InChI | InChI=1S/C9H18N2O2/c1-9(2,3)13-8(12)11-6-4-10-5-7-11/h10H,4-7H2,1-3H3/i4D2,5D2,6D2,7D2 |
InChIKey | CWXPZXBSDSIRCS-DUSUNJSHSA-N |
SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C(=O)OC(C)(C)C)([2H])[2H])[2H] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |