For research use only. Not for therapeutic Use.
N-Boc-N, N-bis(2-chloroethyl)amine(Cat No.:M018544), is a chemical compound used in organic synthesis and medicinal chemistry. Its chemical structure includes a bis(2-chloroethyl)amine moiety and a Boc (tert-butoxycarbonyl) protecting group attached to the nitrogen atom. This compound serves as a valuable intermediate in the preparation of various organic molecules, including pharmaceuticals and agrochemicals.
CAS Number | 118753-70-1 |
Molecular Formula | C9H17Cl2NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | tert-butyl N,N-bis(2-chloroethyl)carbamate |
InChI | InChI=1S/C9H17Cl2NO2/c1-9(2,3)14-8(13)12(6-4-10)7-5-11/h4-7H2,1-3H3 |
InChIKey | FQZLNQAUUMSUHT-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)N(CCCl)CCCl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |