For research use only. Not for therapeutic Use.
N-Boc-L-tyrosine(Cat No.:R061328)is a protected form of the amino acid L-tyrosine, featuring a tert-butoxycarbonyl (Boc) group at the amino terminus. This protection prevents side reactions during peptide synthesis, making it ideal for solid-phase and solution-phase methods. The phenolic side chain remains available for selective modification, enabling incorporation into complex peptide structures and bioactive compounds. N-Boc-L-tyrosine plays a crucial role in pharmaceutical development, combinatorial chemistry, and protein engineering. Supplied at high purity, it is well-suited for research in medicinal chemistry, peptide synthesis, and biochemical pathway studies.
| CAS Number | 3978-80-1 |
| Synonyms | N-[(1,1-Dimethylethoxy)carbonyl]-L-tyrosine; N-Carboxy-L-tyrosine N-tert-Butyl Ester; (2S)-2-[(tert-Butoxycarbonyl)amino]-3-(4-hydroxyphenyl)propanoic Acid; (2S)-2-[(tert-Butoxycarbonyl)amino]-3-(4-hydroxyphenyl)propanoic Acid; BOC-L-tyrosine; N-(ter |
| Molecular Formula | C14H19NO5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2S)-3-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChI | InChI=1S/C14H19NO5/c1-14(2,3)20-13(19)15-11(12(17)18)8-9-4-6-10(16)7-5-9/h4-7,11,16H,8H2,1-3H3,(H,15,19)(H,17,18)/t11-/m0/s1 |
| InChIKey | CNBUSIJNWNXLQQ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |