For research use only. Not for therapeutic Use.
| CAS Number | 24085-03-8 |
| Synonyms | α1-[[(1,1-Dimethylethyl)(phenylmethyl)amino]methyl]-4-hydroxy-1,3-benzenedimethanol; α1-[(Benzyl-tert-butylamino)methyl]-4-hydroxy-m-xylene-α,α’-diol; α1-Benzyl-tert-butylaminomethyl-4-hydroxy-m-xylene-α1,α3-diol; ?1-(4-Hydroxy-3-hydroxymethylphenyl) |
| Molecular Formula | C20H27NO3 |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 4-[2-[benzyl(tert-butyl)amino]-1-hydroxyethyl]-2-(hydroxymethyl)phenol |
| InChI | InChI=1S/C20H27NO3/c1-20(2,3)21(12-15-7-5-4-6-8-15)13-19(24)16-9-10-18(23)17(11-16)14-22/h4-11,19,22-24H,12-14H2,1-3H3 |
| InChIKey | NZBXAYHLQSMNQS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(CC1=CC=CC=C1)CC(C2=CC(=C(C=C2)O)CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |