For research use only. Not for therapeutic Use.
N-Benzoyl-Gly-His-Leu hydrate(Cat No.:I043461)is a synthetic tripeptide derivative commonly used as a biochemical tool in enzymatic and receptor binding studies. Featuring a benzoyl-protected N-terminus, it mimics natural peptide substrates and can interact with various proteases, including angiotensin-converting enzyme (ACE) and metalloproteases. The presence of histidine and leucine residues contributes to its binding affinity and stability, making it useful in investigating enzyme kinetics, peptide transport, and substrate specificity. As a hydrate form, it ensures better solubility and handling in aqueous systems, supporting its application in pharmaceutical and biochemical research.
| CAS Number | 207386-83-2 |
| Molecular Formula | C21H27N5O5.xH2O |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[[(2S)-2-[(2-benzamidoacetyl)amino]-3-(1H-imidazol-5-yl)propanoyl]amino]-4-methylpentanoic acid;hydrate |
| InChI | InChI=1S/C21H27N5O5.H2O/c1-13(2)8-17(21(30)31)26-20(29)16(9-15-10-22-12-24-15)25-18(27)11-23-19(28)14-6-4-3-5-7-14;/h3-7,10,12-13,16-17H,8-9,11H2,1-2H3,(H,22,24)(H,23,28)(H,25,27)(H,26,29)(H,30,31);1H2/t16-,17-;/m0./s1 |
| InChIKey | NWOJMNXIJBZMPK-QJHJCNPRSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NC(=O)[C@H](CC1=CN=CN1)NC(=O)CNC(=O)C2=CC=CC=C2.O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |