For research use only. Not for therapeutic Use.
N-Acetyldesloratadine (CAT: R040702) is a potent, orally active dual antagonist of platelet-activating factor (PAF) and histamine, offering broad-spectrum anti-inflammatory and anti-allergic activity. It effectively inhibits PAF-induced human platelet aggregation, with an IC₅₀ of 0.6 µM, making it a promising candidate for the treatment of PAF-mediated inflammatory conditions. As a derivative of desloratadine, it retains antihistaminic properties while extending its therapeutic potential through PAF receptor antagonism. N-Acetyldesloratadine is valuable for research in allergy, asthma, cardiovascular inflammation, and other pathologies where PAF and histamine signaling contribute to disease progression.
| CAS Number | 117796-52-8 |
| Synonyms | 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone |
| Molecular Formula | C21H21ClN2O |
| Purity | ≥95% |
| IUPAC Name | 1-[4-(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaen-2-ylidene)piperidin-1-yl]ethanone |
| InChI | InChI=1S/C21H21ClN2O/c1-14(25)24-11-8-15(9-12-24)20-19-7-6-18(22)13-17(19)5-4-16-3-2-10-23-21(16)20/h2-3,6-7,10,13H,4-5,8-9,11-12H2,1H3 |
| InChIKey | FLTBEMVEAFMWDD-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC(=C2C3=C(CCC4=C2N=CC=C4)C=C(C=C3)Cl)CC1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
