For research use only. Not for therapeutic Use.
N-[4-(Methanesulfonamido)phenyl]methanesulfonamide(Cat No.:M070930) is a chemical compound with the molecular formula C8H10N2O4S2. It is composed of two methanesulfonamide groups linked to a central phenyl ring. This compound exhibits strong electron-withdrawing properties due to the presence of sulfonamide functional groups, making it valuable in organic synthesis as a building block for pharmaceuticals, agrochemicals, and materials science. Additionally, it serves as a versatile intermediate in the preparation of sulfonamide derivatives and heterocyclic compounds. Research into its synthetic methodologies and applications continues to expand its utility in various fields of chemistry and drug discovery.
| CAS Number | 33256-34-7 |
| Molecular Formula | C8H12N2O4S2 |
| Purity | ≥95% |
| IUPAC Name | N-[4-(methanesulfonamido)phenyl]methanesulfonamide |
| InChI | InChI=1S/C8H12N2O4S2/c1-15(11,12)9-7-3-5-8(6-4-7)10-16(2,13)14/h3-6,9-10H,1-2H3 |
| InChIKey | RHDAIYGGSBJXBM-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)NC1=CC=C(C=C1)NS(=O)(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |