For research use only. Not for therapeutic Use.
N-[4-(Difluoromethoxy)phenyl]acetamide(CAT: L014159) is an aromatic acetamide derivative featuring a para-substituted difluoromethoxy group on the phenyl ring. This compound combines the electron-withdrawing and lipophilic properties of the difluoromethoxy group with the reactivity of the acetamide moiety, making it a valuable intermediate in medicinal and agrochemical research. It serves as a scaffold for the development of bioactive molecules, particularly those targeting inflammation, pain, and central nervous system pathways.
CAS Number | 22236-11-9 |
Molecular Formula | C9H9F2NO2 |
Purity | ≥95% |
IUPAC Name | N-[4-(difluoromethoxy)phenyl]acetamide |
InChI | InChI=1S/C9H9F2NO2/c1-6(13)12-7-2-4-8(5-3-7)14-9(10)11/h2-5,9H,1H3,(H,12,13) |
InChIKey | YZAFOMJODXAJQD-UHFFFAOYSA-N |
SMILES | CC(=O)NC1=CC=C(C=C1)OC(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |