Home
>
Reference Standards> N-[4-Amino-2-chloro-6-[(2-deoxy-2-fluoro-β-D-arabinopyranosyl)amino]-5-pyrimidinyl]-formamide
For research use only. Not for therapeutic Use.
N-[4-Amino-2-chloro-6-[(2-deoxy-2-fluoro-β-D-arabinopyranosyl)amino]-5-pyrimidinyl]-formamide(Cat No.:R025921)is a specialized compound widely used in pharmaceutical research, particularly in the study of antiviral and anticancer agents. This nucleoside analog, featuring a fluorinated sugar moiety and a chlorinated pyrimidine ring, is crucial for investigating mechanisms of drug resistance and DNA synthesis inhibition. Its unique structure allows it to serve as a potent inhibitor in various biochemical pathways, making it an essential tool for drug development and molecular biology research.
CAS Number | 1140251-33-7 |
Synonyms | N-(4-Amino-2-chloro-6-(((2R,3S,4R,5R)-3-fluoro-4,5-dihydroxytetrahydro-2H-pyran-2-yl)amino)pyrimidin-5-yl)formamide |
Molecular Formula | C10H13ClFN5O4 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | N-[4-amino-2-chloro-6-[[(2R,3S,4R,5R)-3-fluoro-4,5-dihydroxyoxan-2-yl]amino]pyrimidin-5-yl]formamide |
InChI | InChI=1S/C10H13ClFN5O4/c11-10-15-7(13)5(14-2-18)8(17-10)16-9-4(12)6(20)3(19)1-21-9/h2-4,6,9,19-20H,1H2,(H,14,18)(H3,13,15,16,17)/t3-,4+,6-,9-/m1/s1 |
InChIKey | GIFVSTNLGMIVGT-AYQXTPAHSA-N |
SMILES | C1C(C(C(C(O1)NC2=NC(=NC(=C2NC=O)N)Cl)F)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |