Home
>
Reference Standards> N-[4-[2-(2-Amino-4,7-dihydro-4-oxo-3H-pyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]-L-glutamic Acid 1,
For research use only. Not for therapeutic Use.
N-(2-Chloro-4-pyrimidinyl)-N,2,3-trimethyl-2H-indazol-6-amine (Cat No.: R015475) is a synthetically derived heterocyclic compound featuring a substituted indazole core and a pyrimidine moiety. The molecule includes multiple methyl groups that influence lipophilicity and binding affinity, while the 2-chloro-4-pyrimidinyl group contributes to its potential bioactivity. This compound is of interest in medicinal chemistry as a kinase inhibitor scaffold or bioactive molecule due to its nitrogen-rich structure, which supports hydrogen bonding and interactions with biological targets. It is explored in drug discovery and molecular pharmacology research.
CAS Number | 165049-28-5 |
Molecular Formula | C31H37N5O9S |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | diethyl (2S)-2-[[4-[2-(2-amino-4-oxo-1,7-dihydropyrrolo[2,3-d]pyrimidin-5-yl)ethyl]benzoyl]amino]pentanedioate;4-methylbenzenesulfonic acid |
InChI | InChI=1S/C24H29N5O6.C7H8O3S/c1-3-34-18(30)12-11-17(23(33)35-4-2)27-21(31)15-8-5-14(6-9-15)7-10-16-13-26-20-19(16)22(32)29-24(25)28-20;1-6-2-4-7(5-3-6)11(8,9)10/h5-6,8-9,13,17H,3-4,7,10-12H2,1-2H3,(H,27,31)(H4,25,26,28,29,32);2-5H,1H3,(H,8,9,10)/t17-;/m0./s1 |
InChIKey | UANBXQTVHOIGGQ-LMOVPXPDSA-N |
SMILES | CCOC(=O)CCC(C(=O)OCC)NC(=O)C1=CC=C(C=C1)CCC2=CNC3=C2C(=O)N=C(N3)N.CC1=CC=C(C=C1)S(=O)(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |