For research use only. Not for therapeutic Use.
N-[3-(4-aminobutylamino)propyl]acetamide(Cat No.:M066528) is a chemical compound with a structure consisting of an acetamide group attached to a propyl chain, which further connects to a butylamine group containing an amino (NH2) group. This compound is commonly used in medicinal chemistry and pharmaceutical research due to its potential biological activities. Its structure suggests possible applications as a ligand in metal coordination complexes or as a substrate for enzymatic reactions. Additionally, it may have therapeutic potential in drug discovery efforts targeting conditions such as neurological disorders or cancer.
CAS Number | 14278-49-0 |
Molecular Formula | C9H21N3O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N-[3-(4-aminobutylamino)propyl]acetamide |
InChI | InChI=1S/C9H21N3O/c1-9(13)12-8-4-7-11-6-3-2-5-10/h11H,2-8,10H2,1H3,(H,12,13) |
InChIKey | MQTAVJHICJWXBR-UHFFFAOYSA-N |
SMILES | CC(=O)NCCCNCCCCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |