For research use only. Not for therapeutic Use.
N-(2,4-Dichlorobenzyl)hydroxylamine hydrochloride (Cat.No:L004013) is a significant compound in chemical synthesis. Its unique structure, featuring a dichlorobenzyl group and a hydroxylamine moiety, imparts distinctive reactivity. This compound serves as a vital intermediate in the preparation of specialized molecules with applications in pharmaceutical and chemical research.
| CAS Number | 139460-29-0 |
| Molecular Formula | C7H8Cl3NO |
| Purity | ≥95% |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride |
| InChI | InChI=1S/C7H7Cl2NO.ClH/c8-6-2-1-5(4-10-11)7(9)3-6;/h1-3,10-11H,4H2;1H |
| InChIKey | RYKQXFMRIUYEHT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CNO.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
